| Motif | Enrichment p-value | Motif #genes | Mod #genes | Enriched GO | Mod |
| GATGAG | e--84 | 108 | 185 | ribosome biogenesis(-144.589732), transcription\, from Pol I promoter(-126.995963), rRNA processing(-109.510329), RNA processing(-78.10537), 35S primary transcript processing(-69.680428), ribosomal large subunit assembly and maintenance(-34.763291), | Mod 911 |
| ACGCGT | e--78 | 49 | 92 | DNA metabolism(-58.77429), mitotic cell cycle(-48.794292), DNA replication and chromosome cycle(-41.630848), S phase of mitotic cell cycle(-38.371016), DNA strand elongation(-25.589376), DNA repair(-23.951899), | Mod 969 |
| AAGGGG | e--64 | 77 | 186 | stress response(-34.175841), carbohydrate metabolism(-33.861338), energy derivation by oxidation of organic compounds(-30.940161), | Mod 1087 |
| TGACTC | e--57 | 52 | 112 | amino acid metabolism(-111.10627), amino acid biosynthesis(-102.360027), | Mod 848 |
| CACAAA | e--47 | 115 | 247 | nuclear division(-83.02673), M phase(-81.224434), sporulation (sensu Saccharomyces)(-56.149515), meiosis(-50.464487), | Mod 2974 |
| AATTTT | e--25 | 62 | 67 | transcription\, from Pol I promoter(-34.587673), ribosome biogenesis(-30.816725), protein biosynthesis(-27.277423), 35S primary transcript processing(-17.94883), RNA processing(-14.769997), | Mod 1807 |
| GATAAG | e--25 | 36 | 72 | amino acid metabolism(-44.173355), glutamine family amino acid metabolism(-31.535824), amino acid biosynthesis(-25.510246), nitrogen metabolism(-22.17458), aspartate family amino acid metabolism(-20.936209), glutamine family amino acid biosynthesis(-19.57587), | Mod 1088 |
| TAAGGG | e--25 | 47 | 137 | energy derivation by oxidation of organic compounds(-32.261361), carbohydrate metabolism(-24.56629), stress response(-10.071242), | Mod 1035 |
| TGAAAC | e--25 | 50 | 93 | mating (sensu Saccharomyces)(-79.978314), cell-cell fusion(-84.05185), response to abiotic stimulus(-13.791899), | Mod 1975 |
| AAATTT | e--24 | 41 | 42 | transcription\, from Pol I promoter(-23.945101), RNA processing(-17.095023), ribosomal large subunit assembly and maintenance(-8.996822), 35S primary transcript processing(-8.362126), | Mod 1127 |
| CACGTG | e--24 | 10 | 11 | phosphate metabolism(-5.098281), | Mod 219 |
| GGTGGC | e--24 | 19 | 40 | ubiquitin-dependent protein degradation(-64.378155), | Mod 1168 |
| CAC7CAC | e--23 | 25 | 65 | | Mod 3053 |
| CC2ACAT | e--22 | 35 | 97 | protein biosynthesis(-119.372562), | Mod 1236 |
| AAAATT | e--21 | 94 | 114 | ribosome biogenesis(-56.957348), transcription\, from Pol I promoter(-43.564377), protein biosynthesis(-38.819646), 35S primary transcript processing(-28.290468), RNA processing(-27.799617), | Mod 1151 |
| CCGTAC | e--21 | 41 | 209 | protein biosynthesis(-338.315184), ribosome biogenesis(-58.439192), | Mod 981 |
| ATATAA | e--21 | 101 | 138 | response to external stimulus(-9.145975), | Mod 1237 |
| GACGCG | e--21 | 9 | 13 | S phase of mitotic cell cycle(-4.925586), DNA replication and chromosome cycle(-6.005672), DNA metabolism(-2.568849), | Mod 1029 |
| AACGCG | e--20 | 19 | 48 | mitotic cell cycle(-13.699144), G2/M transition of mitotic cell cycle(-10.258647), G1/S transition of mitotic cell cycle(-9.588519), DNA metabolism(-7.830014), | Mod 3232 |
| CGG;CCG | e--20 | 8 | 12 | galactose metabolism(-30.907865), | Mod 3270 |
| ACGCGA | e--19 | 20 | 72 | DNA metabolism(-10.43087), M phase(-3.521009), | Mod 2544 |
| CGCGTT | e--19 | 13 | 23 | chromatin assembly/disassembly(-20.497172), cell wall organization and biogenesis(-3.061809), mitotic cell cycle(-1.82473), M phase(-1.818666), | Mod 3222 |
| CGGGTA | e--19 | 32 | 107 | | Mod 3179 |
| CCGCGG | e--19 | 27 | 186 | | Mod 819 |
| GT9TTCG | e--19 | 9 | 10 | chromatin assembly/disassembly(-39.451674), | Mod 2610 |
| GTGGCAA | e--18 | 51 | 440 | macromolecule catabolism(-39.347442), catabolism(-36.023511), | Mod 2780 |
| GGGGTA | e--18 | 21 | 88 | energy derivation by oxidation of organic compounds(-14.748171), carbohydrate metabolism(-10.114626), | Mod 1052 |
| AAATTTTT | e--18 | 31 | 76 | protein biosynthesis(-23.536844), | Mod 2481 |
| CCAATC | e--18 | 28 | 76 | energy derivation by oxidation of organic compounds(-60.191008), phosphorylation(-20.020207), aerobic respiration(-42.648822), energy coupled proton transport\, down the electrochemical gradient(-35.347544), | Mod 1103 |
| CGCGAA | e--18 | 13 | 26 | chromatin assembly/disassembly(-29.598367), S phase of mitotic cell cycle(-3.194807), DNA replication and chromosome cycle(-3.343634), | Mod 1063 |
| GAATCTTAG | e--18 | 5 | 50 | meiosis(-5.819691), sporulation (sensu Fungi)(-3.934164), | Mod 2133 |
| GACTCA | e--18 | 18 | 46 | amino acid metabolism(-50.493474), amino acid biosynthesis(-36.338277), arginine biosynthesis(-25.386426), methionine metabolism(-18.947806), | Mod 1523 |
| TCGCGT | e--17 | 11 | 22 | DNA metabolism(-3.258692), mitotic cell cycle(-2.089468), | Mod 3221 |
| TT8CCCC | e--17 | 15 | 32 | disaccharide metabolism(-7.894492), energy derivation by oxidation of organic compounds(-6.746379), catabolism(-1.695353), | Mod 832 |
| AACATACG | e--17 | 10 | 147 | | Mod 1533 |
| GCGGCT | e--17 | 10 | 16 | meiotic prophase I(-5.827726), sporulation (sensu Saccharomyces)(-4.41387), DNA metabolism(-1.678972), | Mod 1482 |
| GGGGCG | e--17 | 13 | 48 | protein folding(-46.531554), stress response(-30.446199), | Mod 3111 |
| AGG9GGG | e--16 | 12 | 29 | carbohydrate metabolism(-18.425717), stress response(-11.156801), glycogen metabolism(-5.795006), | Mod 1629 |
| CT;GAAA | e--16 | 18 | 22 | transcription\, from Pol II promoter(-3.266153), mitotic cell cycle(-1.712909), protein modification(-1.689567), | Mod 2464 |
| ATGTGCCT | e--16 | 11 | 154 | carbohydrate metabolism(-10.375584), | Mod 3047 |
| GAA4TTT | e--16 | 36 | 44 | protein biosynthesis(-36.851943), ribosome biogenesis(-15.494902), ribosomal large subunit assembly and maintenance(-12.289919), transcription\, from Pol I promoter(-11.995521), RNA processing(-6.540245), | Mod 2160 |
| TG9CCCC | e--16 | 17 | 63 | energy derivation by oxidation of organic compounds(-12.757807), carbohydrate metabolism(-6.311751), | Mod 1062 |
| CA5ACAT | e--16 | 37 | 80 | protein biosynthesis(-54.60309), lipid metabolism(-10.894417), | Mod 2747 |
| TT:ATTA | e--16 | 17 | 17 | RNA metabolism(-2.484124), | Mod 3000 |
| CC6GGAA | e--16 | 22 | 50 | mitotic cell cycle(-12.02538), M phase(-6.048309), | Mod 1067 |
| TC2CCCC | e--16 | 32 | 174 | | Mod 1098 |
| GTCACAAAA | e--16 | 5 | 23 | | Mod 199 |
| TACCCC | e--16 | 14 | 38 | catabolic carbohydrate metabolism(-4.367702), hexose transport(-5.863354), | Mod 109 |
| CCT2ATT | e--16 | 13 | 16 | | Mod 2884 |
| CCC7GGA | e--16 | 9 | 20 | cell wall organization and biogenesis(-3.061809), | Mod 1519 |
| CC1TACA | e--16 | 16 | 32 | protein biosynthesis(-83.094267), | Mod 1198 |
| GTGGCAAAA | e--16 | 6 | 19 | ubiquitin-dependent protein degradation(-9.508182), vacuole organization and biogenesis(-5.208613), RNA localization(-4.909648), exocytosis(-3.330233), | Mod 1085 |
| ACC5GGT | e--16 | 9 | 15 | | Mod 217 |
| TGT4TGT | e--16 | 10 | 11 | | Mod 716 |
| GTAAACA | e--15 | 14 | 35 | chromatin assembly/disassembly(-13.041508), cell cycle control(-4.464786), | Mod 970 |
| TC:AGTC | e--15 | 9 | 13 | arginine biosynthesis(-10.850752), | Mod 3228 |
| CGG3CGG | e--15 | 9 | 23 | amino acid biosynthesis(-3.421526), response to abiotic stimulus(-2.291764), transcription\, DNA-dependent(-1.14379), | Mod 1442 |
| GGC5GGC | e--15 | 7 | 11 | stress response(-8.362051), | Mod 53 |
| GGTGGCAAA | e--15 | 6 | 21 | ubiquitin-dependent protein degradation(-13.226802), actin filament organization(-4.655664), vesicle transport(-1.786724), | Mod 2100 |
| ACA9CAA | e--15 | 18 | 25 | | Mod 1951 |
| TGACTCA | e--15 | 7 | 15 | amino acid biosynthesis(-9.72045), | Mod 846 |
| AA6ACGC | e--15 | 10 | 13 | | Mod 2294 |
| GGCTTA | e--15 | 27 | 100 | | Mod 1072 |
| AAATTTT | e--15 | 15 | 17 | | Mod 907 |
| CT3ATTA | e--15 | 10 | 10 | | Mod 2067 |
| TCC3CAT | e--15 | 19 | 42 | protein biosynthesis(-103.582413), ribosomal large subunit assembly and maintenance(-15.71521), | Mod 1870 |
| GCG:AAC | e--15 | 9 | 15 | chromatin assembly/disassembly(-28.243643), | Mod 1470 |
| CTCATC | e--15 | 18 | 28 | transcription\, from Pol III promoter(-5.806918), RNA processing(-5.825435), ribosome biogenesis(-5.31115), transcription\, from Pol I promoter(-3.543532), | Mod 1204 |
| GGC5CAT | e--15 | 12 | 23 | rRNA modification(-11.187865), transcription\, from Pol I promoter(-5.41847), purine nucleoside monophosphate metabolism(-7.869346), purine nucleotide biosynthesis(-7.201898), protein biosynthesis(-5.365157), | Mod 1065 |
| AT7ATAA | e--15 | 18 | 19 | protein biosynthesis(-5.00874), | Mod 2330 |
| TGT3CGT | e--15 | 9 | 12 | | Mod 2687 |
| TCG6ACC | e--15 | 7 | 10 | | Mod 146 |
| ATGGCTGG | e--15 | 6 | 30 | chromatin assembly/disassembly(-13.448016), cytokinesis(-7.100338), | Mod 1184 |
| ATA;ATG | e--15 | 15 | 18 | protein biosynthesis(-4.018015), RNA metabolism(-2.694567), | Mod 2654 |
| TGTGGCGC | e--14 | 5 | 36 | | Mod 592 |
| TT2AGGG | e--14 | 16 | 29 | stress response(-6.717206), carbohydrate metabolism(-2.647407), | Mod 1074 |
| AG;GCAA | e--14 | 31 | 71 | | Mod 788 |
| AA7CGCG | e--14 | 11 | 23 | lipid metabolism(-4.322993), DNA metabolism(-2.447952), mitotic cell cycle(-1.612145), | Mod 1082 |
| GTGGCAAA | e--14 | 7 | 19 | ubiquitin-dependent protein degradation(-35.162253), vesicle transport(-1.979856), | Mod 2014 |
| CG5GTCC | e--14 | 9 | 26 | glucose metabolism(-4.876886), catabolic carbohydrate metabolism(-4.367702), RNA processing(-2.977028), catabolism(-1.422193), transcription\, DNA-dependent(-1.076588), | Mod 1285 |
| AAAAATT | e--14 | 31 | 46 | protein biosynthesis(-27.867434), | Mod 1095 |
| CC;ATCC | e--14 | 17 | 55 | | Mod 642 |
| TCCTGCCT | e--14 | 5 | 22 | exocytosis(-2.594156), amino acid and derivative metabolism(-2.481746), protein biosynthesis(-2.303198), protein modification(-1.589516), | Mod 2287 |
| AGGGAG | e--14 | 22 | 77 | carbohydrate metabolism(-11.371161), stress response(-8.382099), | Mod 1081 |
| CATGTG | e--14 | 13 | 27 | phosphatidylcholine biosynthesis(-13.975369), | Mod 721 |
| CC6CTCC | e--14 | 12 | 32 | hexose transport(-22.961487), | Mod 2390 |
| GAG4AGT | e--14 | 12 | 21 | protein modification(-2.063991), | Mod 2704 |
| TT3CAAT | e--14 | 14 | 15 | protein biosynthesis(-15.246006), | Mod 2282 |
| CCC6CGG | e--14 | 11 | 48 | energy derivation by oxidation of organic compounds(-4.791972), stress response(-4.475902), catabolism(-1.838248), | Mod 833 |
| TAATTC | e--14 | 10 | 12 | | Mod 2996 |
| AAA1AAT | e--14 | 43 | 48 | protein biosynthesis(-15.051498), | Mod 1125 |
| GAGTCA | e--14 | 9 | 14 | amino acid biosynthesis(-5.764885), | Mod 3167 |
| CCA2CAT | e--14 | 13 | 21 | protein biosynthesis(-52.318132), ribosome biogenesis(-4.52222), | Mod 3204 |
| CA5CGTA | e--14 | 9 | 14 | | Mod 3244 |
| GC3CATT | e--14 | 22 | 50 | | Mod 1078 |
| AAAATTT | e--14 | 16 | 19 | transcription\, from Pol I promoter(-16.510518), ribosome biogenesis(-15.202992), RNA processing(-12.252903), | Mod 3040 |
| AA2TTTT | e--14 | 50 | 58 | protein biosynthesis(-48.22891), ribosome biogenesis(-19.578496), RNA processing(-5.608442), | Mod 1152 |
| AAAATTTT | e--14 | 16 | 29 | protein biosynthesis(-19.307879), 35S primary transcript processing(-10.882202), ribosome biogenesis(-15.250703), RNA processing(-11.233637), rRNA modification(-10.645174), | Mod 1778 |
| TTCTAGAA | e--14 | 6 | 13 | protein folding(-24.131792), stress response(-11.70734), | Mod 43 |
| TC7ACAT | e--14 | 12 | 16 | | Mod 888 |
| GTTATTAT | e--14 | 6 | 11 | | Mod 2626 |
| AGGGAT | e--14 | 9 | 13 | | Mod 443 |
| CAC3GGC | e--14 | 8 | 15 | amino acid biosynthesis(-4.325114), | Mod 54 |
| CCCCCT | e--14 | 14 | 51 | stress response(-4.034812), protein targeting(-3.932271), | Mod 1090 |
| CTC6ACC | e--14 | 10 | 20 | galactose metabolism(-9.601568), | Mod 2433 |
| GG8GGGG | e--14 | 11 | 40 | stress response(-12.615803), | Mod 891 |
| GTGGCA | e--14 | 22 | 59 | ubiquitin-dependent protein degradation(-33.25939), response to external stimulus(-4.374802), | Mod 2055 |
| AT1ATCA | e--14 | 12 | 13 | pyridoxine metabolism(-11.878837), | Mod 2501 |
| TCCACC | e--13 | 8 | 11 | mating-type specific transcriptional control(-14.17989), | Mod 168 |
| CGCCGT | e--13 | 11 | 33 | | Mod 878 |
| CGC6GGC | e--13 | 6 | 10 | | Mod 1832 |
| GCG2GAG | e--13 | 9 | 16 | | Mod 2688 |
| GT3ATCA | e--13 | 11 | 15 | | Mod 2046 |
| TTT7ACC | e--13 | 16 | 23 | establishment of cell polarity (sensu Fungi)(-4.292584), establishment and/or maintenance of cell polarity (sensu Saccharomyces)(-4.265734), | Mod 552 |
| ACA3CAC | e--13 | 8 | 10 | vesicle transport(-4.481869), | Mod 3114 |
| AAA1ATT | e--13 | 31 | 34 | protein biosynthesis(-11.520581), transcription\, from Pol I promoter(-4.370652), | Mod 2662 |
| TA1ACGA | e--13 | 14 | 38 | ergosterol metabolism(-19.00217), sterol metabolism(-27.642463), stress response(-4.127667), | Mod 144 |
| GC3CGGC | e--13 | 7 | 14 | amino acid biosynthesis(-4.773843), | Mod 52 |
| CG1GGAC | e--13 | 6 | 10 | | Mod 3183 |
| CGT7CAC | e--13 | 29 | 169 | | Mod 828 |
| TCC7GGA | e--13 | 8 | 12 | | Mod 1528 |
| CCAATCA | e--13 | 7 | 15 | aerobic respiration(-24.921382), complex III (ubiquinone to cytochrome c)(-13.943558), ion transport(-3.650845), | Mod 3106 |
| GG1AGGA | e--13 | 10 | 16 | amino acid metabolism(-4.369326), | Mod 56 |
| CCGCGGA | e--13 | 5 | 13 | iron-siderophore transport(-13.081788), | Mod 1362 |
| CGA3GAT | e--13 | 15 | 39 | transcription\, from Pol I promoter(-14.336101), RNA processing(-12.116177), 35S primary transcript processing(-4.655664), RNA modification(-8.941684), nucleotide metabolism(-5.965979), protein biosynthesis(-2.010097), | Mod 2679 |
| AA5ATGA | e--13 | 11 | 11 | | Mod 2844 |
| GTTTAA | e--13 | 11 | 13 | methionine metabolism(-8.247144), amino acid biosynthesis(-5.372277), | Mod 1428 |
| CGCGGA | e--13 | 10 | 31 | hexose transport(-20.693803), | Mod 3166 |
| GG2GCAA | e--13 | 16 | 34 | ubiquitin-dependent protein degradation(-16.674015), stress response(-2.027795), | Mod 2273 |
| CAT:TAG | e--13 | 13 | 22 | meiosis(-8.443848), DNA metabolism(-5.964588), mitosis(-2.803831), DNA replication and chromosome cycle(-2.081145), | Mod 1645 |
| CAC8CCG | e--13 | 9 | 22 | chromatin assembly/disassembly(-6.673603), | Mod 2261 |
| CA7GAGC | e--13 | 9 | 15 | DNA metabolism(-2.568849), | Mod 2809 |
| AGT8ATT | e--13 | 12 | 14 | | Mod 2800 |
| CGGCTA | e--13 | 9 | 18 | meiosis(-4.766072), | Mod 1818 |
| TA5GTCC | e--13 | 13 | 32 | amino acid metabolism(-3.624481), DNA replication and chromosome cycle(-2.794823), | Mod 1312 |
| AA2CGCG | e--13 | 7 | 10 | | Mod 2519 |
| AT9AAAC | e--13 | 12 | 13 | mating (sensu Fungi)(-11.559888), | Mod 2672 |
| AGGCAC | e--13 | 19 | 69 | pyridoxine metabolism(-25.391885), coenzymes and prosthetic group metabolism(-22.002958), | Mod 652 |
| CTCAACG | e--13 | 8 | 32 | mitotic cell cycle(-1.949461), | Mod 1503 |
| TT8TCGC | e--13 | 26 | 69 | RNA processing(-7.470694), transcription\, from Pol I promoter(-14.440797), protein biosynthesis(-8.858681), | Mod 1154 |
| TC2TAGT | e--13 | 22 | 51 | | Mod 2854 |
| TG2CATT | e--13 | 28 | 57 | | Mod 1218 |
| GAA3TTT | e--13 | 38 | 49 | protein biosynthesis(-4.860314), | Mod 1026 |
| TTACTAA | e--13 | 16 | 49 | aldehyde metabolism(-22.559253), oxidative stress response(-15.347454), | Mod 3245 |
| TT1TTTT | e--13 | 46 | 47 | | Mod 2482 |
| AAAACCC | e--13 | 8 | 17 | | Mod 567 |
| TT2TTTC | e--13 | 223 | 315 | | Mod 1038 |
| GCC5CCC | e--13 | 9 | 27 | response to external stimulus(-2.79294), | Mod 524 |
| CC1CCAG | e--13 | 19 | 80 | sporulation (sensu Saccharomyces)(-5.230889), | Mod 944 |
| GCGATG | e--13 | 18 | 43 | RNA processing(-4.547797), transcription\, from Pol I promoter(-7.680422), | Mod 1854 |
| GCACGTG | e--13 | 11 | 82 | | Mod 955 |
| AA:ATTG | e--13 | 36 | 56 | vesicle transport(-6.983603), response to external stimulus(-2.445445), | Mod 2761 |
| CGC5ATC | e--13 | 7 | 11 | mitotic cell cycle(-6.281765), cytoskeleton organization and biogenesis(-3.83496), | Mod 1935 |
| CCGATA | e--13 | 7 | 10 | ergosterol metabolism(-26.574879), steroid biosynthesis(-24.787227), | Mod 1146 |
| GG9GGTG | e--13 | 8 | 17 | heavy metal ion homeostasis(-6.598244), di-\, tri-valent inorganic cation homeostasis(-6.291022), | Mod 1422 |
| TT9CCCC | e--13 | 12 | 27 | hexose transport(-6.570122), carbohydrate metabolism(-4.861896), | Mod 2018 |
| AAA1TCC | e--13 | 10 | 12 | | Mod 1514 |
| CTG9AGC | e--13 | 23 | 95 | protein modification(-7.37941), | Mod 213 |
| TCCGCGG | e--13 | 6 | 20 | iron-siderophore transport(-16.106985), heavy metal ion transport(-5.881825), di-\, tri-valent inorganic cation transport(-5.533883), energy derivation by oxidation of organic compounds(-2.624296), | Mod 2533 |
| CCTTCTA | e--13 | 6 | 10 | protein biosynthesis(-25.532505), protein synthesis elongation(-8.001683), | Mod 112 |
| GA8CCCC | e--13 | 7 | 14 | metabolism of energy reserves(-6.809211), carbohydrate metabolism(-6.130762), stress response(-3.357688), | Mod 1761 |
| ACTCCG | e--13 | 15 | 60 | energy derivation by oxidation of organic compounds(-4.343513), | Mod 3050 |
| CTTATC | e--13 | 9 | 11 | purine base metabolism(-9.024139), catabolism(-3.518122), | Mod 2568 |
| TT3GAGC | e--13 | 10 | 15 | | Mod 573 |
| GG3ATTA | e--13 | 8 | 10 | | Mod 687 |
| AG3CAAT | e--13 | 13 | 21 | | Mod 679 |
| ACG2GAC | e--13 | 9 | 17 | | Mod 1391 |
| GGA4GGA | e--13 | 11 | 21 | amino acid biosynthesis(-3.542178), protein modification(-1.589516), DNA metabolism(-1.367927), transcription\, DNA-dependent(-1.21937), | Mod 531 |
| TA2GGGC | e--13 | 22 | 92 | ubiquitin-dependent protein degradation(-39.709785), catabolism(-33.72014), stress response(-8.053202), | Mod 1023 |
| ATT6CCC | e--13 | 12 | 22 | cation transport(-4.586081), response to external stimulus(-3.595537), | Mod 3007 |
| GCA1GAT | e--13 | 9 | 13 | | Mod 507 |
| GC:CCGC | e--13 | 12 | 44 | | Mod 893 |
| TTT2TCC | e--13 | 11 | 11 | | Mod 325 |
| TT6TGTA | e--13 | 21 | 29 | protein biosynthesis(-56.747735), protein synthesis elongation(-9.461224), | Mod 674 |
| CC7ACCG | e--13 | 8 | 19 | ergosterol metabolism(-5.836371), steroid biosynthesis(-5.184752), amino acid metabolism(-4.566667), hexose metabolism(-4.286269), response to abiotic stimulus(-2.400245), | Mod 1985 |
| AG9TCTG | e--13 | 16 | 36 | response to abiotic stimulus(-2.518299), protein modification(-1.689567), DNA metabolism(-1.459932), | Mod 560 |
| GGAAGA | e--13 | 13 | 16 | mitotic cell cycle(-1.949461), | Mod 2849 |
| GTC;CTT | e--13 | 15 | 28 | | Mod 566 |
| AA8CACT | e--13 | 9 | 10 | | Mod 1791 |
| TA9ACCT | e--13 | 11 | 17 | cytoskeleton organization and biogenesis(-2.510418), | Mod 1563 |
| TA1GTGC | e--13 | 13 | 32 | | Mod 1641 |
| TC:TTCC | e--13 | 32 | 79 | | Mod 967 |
| GC2AGAC | e--13 | 8 | 14 | protein biosynthesis(-34.432531), | Mod 93 |
| CTTGGC | e--13 | 9 | 12 | sporulation (sensu Saccharomyces)(-8.502497), | Mod 1170 |
| TTCCAAT | e--13 | 7 | 10 | | Mod 442 |
| TAC9GCA | e--12 | 11 | 20 | | Mod 1341 |
| CGCCCC | e--12 | 7 | 17 | glucose metabolism(-6.162243), gluconeogenesis(-7.380378), catabolic carbohydrate metabolism(-5.639328), catabolism(-2.408449), | Mod 3112 |
| GGAAGC | e--12 | 12 | 22 | | Mod 201 |
| GTG;CTA | e--12 | 7 | 10 | | Mod 2406 |
| TCA6ACG | e--12 | 30 | 80 | protein modification(-3.84182), | Mod 2727 |
| TT9CGCG | e--12 | 9 | 16 | axial budding(-7.276382), cell wall organization and biogenesis(-3.552969), mitotic cell cycle(-2.247831), M phase(-2.241234), protein modification(-2.221642), | Mod 1371 |
| ACA:AGC | e--12 | 8 | 10 | | Mod 2665 |
| CA6TAAG | e--12 | 11 | 16 | | Mod 1057 |
| CGACGC | e--12 | 7 | 14 | cytoskeleton organization and biogenesis(-2.697642), | Mod 3062 |
| TC4CGTC | e--12 | 11 | 30 | DNA replication and chromosome cycle(-2.317083), M phase(-1.818666), DNA metabolism(-1.562996), | Mod 650 |
| TT5ATAA | e--12 | 16 | 17 | hexose transport(-15.485684), | Mod 2391 |
| GG5CGCG | e--12 | 12 | 56 | mitotic cell cycle(-6.584274), cell wall organization and biogenesis(-3.658087), | Mod 3208 |
| TGTTTCA | e--12 | 8 | 13 | | Mod 655 |
| TT9CCTC | e--12 | 25 | 57 | protein modification(-7.772993), | Mod 1266 |
| TAGTCAG | e--12 | 6 | 19 | | Mod 1607 |
| GGGTGC | e--12 | 11 | 35 | amino acid transport(-8.677952), amino acid biosynthesis(-7.425475), | Mod 238 |
| AGGGGC | e--12 | 11 | 28 | stress response(-11.041492), protein folding(-5.565167), protein targeting(-2.885779), | Mod 616 |
| GC2CTCA | e--12 | 10 | 20 | mismatch repair(-10.331329), DNA metabolism(-10.269934), S phase of mitotic cell cycle(-5.653198), DNA replication and chromosome cycle(-3.507295), cell cycle control(-3.137473), response to external stimulus(-1.451641), | Mod 737 |
| AAGCCTG | e--12 | 5 | 10 | transcription\, DNA-dependent(-3.444774), | Mod 2935 |
| GCC3TTC | e--12 | 10 | 16 | | Mod 2856 |
| TC2AAAA | e--12 | 14 | 16 | xenobiotic response(-6.210559), amino acid metabolism(-4.054727), | Mod 62 |
| ATA6GGT | e--12 | 15 | 28 | ubiquitin-dependent protein degradation(-4.403329), | Mod 2873 |
| GGCGGC | e--12 | 7 | 12 | meiosis(-9.281359), | Mod 385 |
| TGA1TCA | e--12 | 13 | 22 | glutamine family amino acid biosynthesis(-6.126103), sulfate assimilation(-14.501298), methionine metabolism(-10.815145), | Mod 2052 |
| CTC4CCG | e--12 | 9 | 24 | stress response(-2.938876), response to external stimulus(-2.16462), | Mod 2457 |
| TCGTGCT | e--12 | 9 | 46 | proteolysis and peptidolysis(-2.342539), vesicle transport(-1.786724), | Mod 1130 |
| GGGCCCC | e--12 | 5 | 19 | hexose transport(-6.946625), metabolism of energy reserves(-6.343635), carbohydrate metabolism(-5.418319), | Mod 2536 |
| TA4TAGG | e--12 | 32 | 120 | amino acid metabolism(-15.156232), | Mod 3264 |
| AAA6AGC | e--12 | 28 | 44 | | Mod 1158 |
| CGA7ACT | e--12 | 11 | 25 | ER to Golgi transport(-11.213016), | Mod 2719 |
| TTA5AGG | e--12 | 14 | 26 | arginine metabolism(-8.296545), | Mod 1002 |
| TTG2GAC | e--12 | 8 | 11 | mitotic cell cycle(-5.630711), protein modification(-3.148253), transcription\, DNA-dependent(-2.644173), | Mod 1263 |
| AG3GCTC | e--12 | 9 | 17 | | Mod 2683 |
| CT6GGCG | e--12 | 11 | 35 | mitochondrial translocation(-11.457425), | Mod 1711 |
| CC3TTCC | e--12 | 11 | 19 | stress response(-7.473386), | Mod 2458 |
| CGC9CAC | e--12 | 13 | 47 | | Mod 1984 |
| CG6TTGG | e--12 | 7 | 10 | | Mod 2560 |
| CAC8TGA | e--12 | 11 | 21 | amino acid biosynthesis(-4.325114), | Mod 190 |
| AGT1AGG | e--12 | 8 | 13 | | Mod 1557 |
| TATCTA | e--12 | 10 | 12 | | Mod 272 |
| TCT9ATT | e--12 | 22 | 30 | protein modification(-1.416942), | Mod 1012 |
| GGC2CTA | e--12 | 9 | 19 | meiosis(-7.212169), sporulation (sensu Fungi)(-4.805782), S phase of mitotic cell cycle(-4.414041), DNA metabolism(-3.832069), | Mod 649 |
| GAC4ATC | e--12 | 7 | 10 | | Mod 916 |
| AA:TATC | e--12 | 40 | 75 | protein biosynthesis(-66.016031), | Mod 923 |
| GCC1CAA | e--12 | 16 | 47 | mating (sensu Fungi)(-4.054356), | Mod 152 |
| ATT5GTA | e--12 | 11 | 13 | nuclear division(-2.826557), | Mod 2144 |
| GTA9CAA | e--12 | 12 | 17 | RNA processing(-4.463729), | Mod 3127 |
| TTG4CAG | e--12 | 31 | 94 | DNA metabolism(-1.895739), | Mod 837 |
| AGC:CGA | e--12 | 15 | 58 | protein biosynthesis(-11.458739), | Mod 2721 |
| CC;TTCT | e--12 | 25 | 50 | | Mod 1105 |
| ATA3ATA | e--12 | 60 | 83 | carbohydrate metabolism(-6.601763), | Mod 903 |
| CTCCTT | e--12 | 11 | 15 | carbohydrate metabolism(-4.120891), catabolism(-3.155461), | Mod 1156 |
| GA3TTCA | e--12 | 9 | 10 | | Mod 2279 |
| CTC7TCA | e--12 | 13 | 23 | 35S primary transcript processing(-5.718543), transcription\, from Pol I promoter(-6.870261), | Mod 2660 |
| CT6CGGC | e--12 | 6 | 10 | response to abiotic stimulus(-4.501348), | Mod 703 |
| CG:CCGA | e--12 | 7 | 20 | protein modification(-3.025851), vesicle transport(-2.090185), | Mod 879 |
| AC9AGCC | e--12 | 8 | 14 | | Mod 324 |
| GGATCG | e--12 | 6 | 10 | | Mod 1155 |
| TG3ATAA | e--12 | 30 | 52 | protein modification(-2.233122), | Mod 809 |
| CTA7GTT | e--12 | 9 | 13 | | Mod 1657 |
| AC4TCCG | e--12 | 7 | 13 | sporulation (sensu Saccharomyces)(-9.199241), nuclear division(-3.299025), | Mod 80 |
| AA;CTTT | e--12 | 13 | 13 | | Mod 3227 |
| ATC1TAG | e--12 | 16 | 39 | meiosis I(-6.751797), | Mod 543 |
| GCC6CCC | e--12 | 6 | 11 | | Mod 1930 |
| GAG3GAC | e--12 | 15 | 53 | protein modification(-1.926646), | Mod 3164 |
| AT3AGAC | e--12 | 8 | 10 | | Mod 2645 |
| AAA8GAA | e--12 | 25 | 27 | | Mod 1581 |
| CA8GGGC | e--12 | 8 | 18 | stress response(-3.617555), | Mod 2098 |
| TTCGCG | e--12 | 9 | 18 | cell wall organization and biogenesis(-14.197326), | Mod 3182 |
| ATG4GTC | e--12 | 10 | 23 | mating (sensu Saccharomyces)(-21.50426), mating (sensu Fungi)(-25.916337), zygote formation (sensu Fungi)(-6.38266), pheromone response (sensu Fungi)(-5.873002), | Mod 1966 |
| AT9CGCA | e--12 | 8 | 12 | protein biosynthesis(-14.030355), | Mod 115 |
| ATT3AAA | e--12 | 19 | 21 | | Mod 2341 |
| TT:GAAC | e--12 | 24 | 45 | transcription\, DNA-dependent(-6.993833), | Mod 2808 |
| TG1CTCA | e--12 | 9 | 14 | amino acid metabolism(-22.967394), methionine metabolism(-7.628791), amino acid biosynthesis(-8.035744), nitrogen metabolism(-6.809211), glutamine family amino acid metabolism(-6.291022), | Mod 1521 |
| CGT5CAC | e--12 | 8 | 17 | | Mod 448 |
| TG4GCAC | e--12 | 12 | 31 | | Mod 2068 |
| AA7AGGG | e--12 | 26 | 65 | stress response(-9.680347), carbohydrate metabolism(-4.001799), | Mod 816 |
| CAA5GCG | e--12 | 10 | 20 | | Mod 1675 |
| TT7CTAA | e--12 | 16 | 22 | transcription\, from Pol II promoter(-6.073598), vesicle transport(-2.345861), | Mod 805 |
| ACG9GCA | e--12 | 15 | 45 | | Mod 2480 |
| AT2CTAA | e--12 | 10 | 12 | amino acid biosynthesis(-5.764885), | Mod 2446 |
| CT1ATCG | e--12 | 9 | 14 | amino acid biosynthesis(-11.323941), aspartate family amino acid metabolism(-6.286562), | Mod 3097 |
| CT4AGCT | e--12 | 12 | 24 | | Mod 1554 |
| GCTAAC | e--12 | 9 | 17 | | Mod 447 |
| CAG;GAT | e--12 | 9 | 14 | 35S primary transcript processing(-6.180692), RNA processing(-7.973127), ribosome biogenesis(-6.845402), | Mod 29 |
| CCT6TGT | e--12 | 26 | 81 | | Mod 983 |
| TT7GATG | e--12 | 10 | 12 | ribosome biogenesis(-6.140933), | Mod 2189 |
| CCC;AGT | e--12 | 8 | 16 | protein biosynthesis(-7.894039), | Mod 1562 |
| AC:TCAT | e--12 | 9 | 11 | protein modification(-3.148253), | Mod 2915 |
| CC4GGGC | e--12 | 6 | 12 | chromatin assembly/disassembly(-7.803371), mitotic cell cycle(-2.883092), | Mod 1947 |
| CG3AGAA | e--12 | 39 | 131 | | Mod 236 |
| CG3CGCG | e--12 | 6 | 14 | DNA dependent DNA replication(-6.764315), | Mod 1981 |
| AAA1TTT | e--12 | 92 | 126 | protein biosynthesis(-87.19667), ribosome biogenesis(-20.799009), | Mod 1108 |
| CTC9TCG | e--12 | 7 | 13 | arginine biosynthesis(-9.936847), | Mod 270 |
| GTG:ATA | e--12 | 8 | 10 | | Mod 3009 |
| TA2TTTT | e--12 | 39 | 45 | protein biosynthesis(-81.30414), | Mod 1764 |
| TCA8TTA | e--12 | 12 | 15 | transcription\, from Pol I promoter(-5.478148), ribosome biogenesis(-4.97582), RNA processing(-3.852919), | Mod 2110 |
| CAA;AAA | e--12 | 15 | 15 | transcription\, DNA-dependent(-1.777062), | Mod 2863 |
| TAG6GGG | e--12 | 9 | 24 | RNA processing(-2.714188), mitotic cell cycle(-2.428674), | Mod 1342 |
| AT4TTCA | e--12 | 12 | 13 | | Mod 612 |
| CA1GGGC | e--12 | 9 | 22 | protein amino acid glycosylation(-4.478473), glycoprotein biosynthesis(-4.478473), | Mod 1270 |
| CGG7CAA | e--12 | 14 | 45 | tricarboxylic acid cycle(-29.157554), TCA intermediate metabolism(-25.799335), energy derivation by oxidation of organic compounds(-22.492859), phosphorylation(-6.1507), | Mod 2077 |
| ATA7GAT | e--12 | 13 | 17 | | Mod 138 |
| AGT2TGA | e--12 | 27 | 68 | bud growth(-5.809766), M phase(-1.707023), | Mod 334 |
| TGGGGT | e--12 | 8 | 15 | | Mod 186 |
| CG3GGTT | e--12 | 9 | 24 | stress response(-10.46266), protein folding(-5.371167), protein targeting(-2.713816), | Mod 57 |
| TC2ACGC | e--12 | 7 | 13 | | Mod 464 |
| CCA9GTG | e--12 | 19 | 74 | | Mod 1166 |
| GTA2ACA | e--12 | 11 | 17 | transcription regulation(-2.697755), | Mod 1313 |
| TTG8CGA | e--12 | 13 | 29 | amino acid metabolism(-11.615689), | Mod 438 |
| TTA4ATG | e--12 | 11 | 14 | transcription\, DNA-dependent(-2.365561), | Mod 1705 |
| TA3CTGA | e--12 | 8 | 10 | spore wall assembly (sensu Saccharomyces)(-8.43449), | Mod 735 |
| TC4ATAA | e--12 | 25 | 42 | cell wall organization and biogenesis(-2.927293), DNA metabolism(-1.459932), | Mod 1227 |
| TCATCG | e--12 | 22 | 45 | 35S primary transcript processing(-12.841216), transcription\, from Pol I promoter(-17.520488), protein biosynthesis(-14.581254), ribosomal large subunit assembly and maintenance(-10.269354), | Mod 3036 |
| CGC3TCT | e--12 | 10 | 23 | nucleocytoplasmic transport(-4.043263), protein targeting(-2.560206), | Mod 1295 |
| CCG7CGG | e--12 | 6 | 13 | aerobic respiration(-9.472641), electron transport(-7.745379), | Mod 2231 |
| CC9ACGT | e--12 | 12 | 40 | | Mod 1556 |
| GT:GACC | e--12 | 12 | 46 | protein biosynthesis(-6.436979), response to external stimulus(-5.956004), | Mod 2491 |
| CGG1AGA | e--12 | 10 | 21 | | Mod 2702 |
| GA5ACTG | e--12 | 15 | 37 | amino acid metabolism(-13.294555), | Mod 436 |
| ACATCC | e--12 | 13 | 28 | protein biosynthesis(-70.31984), | Mod 1086 |
| CT9TAAG | e--12 | 9 | 13 | | Mod 1969 |
| GGC;TGA | e--12 | 7 | 10 | amino acid transport(-7.599978), | Mod 3080 |
| CT6CTAT | e--12 | 8 | 11 | amino acid biosynthesis(-5.764885), | Mod 2428 |
| TAG:CAT | e--12 | 13 | 23 | transcription\, from Pol I promoter(-5.611327), ribosome biogenesis(-2.818943), protein biosynthesis(-2.303198), | Mod 2897 |
| CG1AGAC | e--11 | 10 | 25 | | Mod 94 |
| GCG9CAC | e--11 | 7 | 17 | | Mod 3116 |
| AATTTC | e--11 | 20 | 25 | protein biosynthesis(-45.335749), ribosomal large subunit assembly and maintenance(-7.883933), | Mod 745 |
| TGT6CTC | e--11 | 8 | 11 | chromatin assembly/disassembly(-12.728406), | Mod 1464 |
| CC1GGAA | e--11 | 16 | 47 | DNA metabolism(-1.414066), | Mod 1104 |
| CAC5GTG | e--11 | 7 | 12 | transcription\, DNA-dependent(-3.860648), | Mod 598 |
| AGT7GTT | e--11 | 10 | 14 | | Mod 2590 |
| AC1CGAA | e--11 | 8 | 12 | mitotic cell cycle(-8.500186), | Mod 419 |
| CTC1AAA | e--11 | 10 | 12 | | Mod 2833 |
| TC1CCAA | e--11 | 11 | 17 | | Mod 1360 |
| TTC7ATT | e--11 | 21 | 27 | cell wall organization and biogenesis(-3.061809), response to abiotic stimulus(-2.647407), protein modification(-1.800676), | Mod 2794 |
| GT7TCCC | e--11 | 14 | 46 | | Mod 110 |
| TT9CGCC | e--11 | 12 | 28 | protein targeting(-5.291267), | Mod 1010 |
| CC3GTGG | e--11 | 7 | 13 | protein biosynthesis(-10.217199), | Mod 2283 |
| AC8TCAG | e--11 | 10 | 19 | | Mod 1976 |
| AA7ACGG | e--11 | 15 | 36 | mating (sensu Fungi)(-4.054356), | Mod 405 |
| CT8GGCG | e--11 | 6 | 10 | | Mod 2336 |
| GT6TTCT | e--11 | 12 | 15 | | Mod 1611 |
| AA4TTGG | e--11 | 12 | 15 | mating (sensu Fungi)(-7.521256), | Mod 1618 |
| CTC6TAA | e--11 | 12 | 20 | | Mod 2180 |
| AC4GCCG | e--11 | 9 | 30 | amino acid biosynthesis(-13.214499), aromatic amino acid family metabolism(-6.857644), | Mod 953 |
| ATT8GGT | e--11 | 12 | 19 | mating (sensu Fungi)(-4.879828), | Mod 1674 |
| GCA3CGC | e--11 | 6 | 11 | | Mod 2559 |
| CGT1GCC | e--11 | 9 | 24 | ergosterol metabolism(-32.982426), steroid biosynthesis(-35.203803), | Mod 2199 |
| CG2TTCC | e--11 | 12 | 31 | response to biotic stimulus(-3.108657), DNA metabolism(-2.810434), stress response(-2.472334), | Mod 986 |
| CAC7AGC | e--11 | 9 | 17 | | Mod 87 |
| TT2GGTG | e--11 | 9 | 13 | protein biosynthesis(-9.290276), | Mod 1531 |
| CAT4GCA | e--11 | 13 | 25 | | Mod 928 |
| CCC7ACT | e--11 | 9 | 21 | hexose metabolism(-5.090751), | Mod 183 |
| ATG5TCT | e--11 | 12 | 18 | protein modification(-2.610084), protein biosynthesis(-2.230206), | Mod 2314 |
| GT:AGTT | e--11 | 11 | 17 | protein modification(-3.688491), amino acid metabolism(-3.179445), stress response(-2.766035), cytoskeleton organization and biogenesis(-2.345673), | Mod 1821 |
| GCG1GGT | e--11 | 8 | 22 | protein modification(-2.063991), | Mod 2786 |
| CG2CTGC | e--11 | 7 | 16 | mitotic cell cycle(-2.883092), | Mod 1281 |
| TA:ATAA | e--11 | 17 | 20 | | Mod 1499 |
| CTT1CAT | e--11 | 10 | 12 | | Mod 1579 |
| GCT3CCG | e--11 | 7 | 15 | glutamine family amino acid metabolism(-10.831896), aspartate family amino acid metabolism(-6.815308), amino acid biosynthesis(-5.048664), catabolism(-2.8618), response to external stimulus(-2.79294), | Mod 2978 |
| GG:CGCG | e--11 | 10 | 53 | mitotic cell cycle(-8.595118), DNA metabolism(-7.321676), cell cycle control(-5.499034), M phase(-4.910821), | Mod 3231 |
| TA8CTCA | e--11 | 30 | 87 | | Mod 2930 |
| TTT4TCC | e--11 | 64 | 129 | | Mod 2292 |
| TA6ATGC | e--11 | 13 | 24 | | Mod 637 |
| GG5GGCT | e--11 | 7 | 21 | amino acid biosynthesis(-8.035744), | Mod 2545 |
| CGG;CCC | e--11 | 7 | 24 | main pathways of carbohydrate metabolism(-8.230189), | Mod 15 |
| TTT9ATT | e--11 | 19 | 19 | microtubule cytoskeleton organization and biogenesis(-4.665541), spindle pole body and microtubule cycle (sensu Saccharomyces)(-5.4649), meiosis(-4.256947), DNA metabolism(-2.131928), | Mod 1414 |
| TA;GTTA | e--11 | 11 | 15 | phospholipid metabolism(-5.507012), | Mod 700 |
| AA4ACGA | e--11 | 13 | 19 | RNA processing(-4.180671), mRNA-nucleus export(-5.275796), transcription\, from Pol I promoter(-3.863015), | Mod 811 |
| CAA8TCA | e--11 | 9 | 10 | | Mod 1400 |
| GC3TGAA | e--11 | 12 | 19 | amino acid biosynthesis(-5.372277), | Mod 437 |
| GGC8GCG | e--11 | 6 | 13 | | Mod 615 |
| CTC6TCT | e--11 | 12 | 19 | mating (sensu Fungi)(-5.984537), cell-cell fusion(-3.555035), cell wall organization and biogenesis(-3.209231), | Mod 1238 |
| CA:GGGC | e--11 | 9 | 24 | ergosterol metabolism(-8.850927), steroid biosynthesis(-7.847262), amino acid metabolism(-3.897652), | Mod 1314 |
| GAATTT | e--11 | 17 | 22 | | Mod 949 |
| ACCCCC | e--11 | 8 | 24 | hexose transport(-20.211027), | Mod 2387 |
| ACC:CTG | e--11 | 9 | 20 | catabolism(-3.518122), | Mod 1423 |
| TG3AGGA | e--11 | 9 | 13 | | Mod 2653 |
| AA2TCAT | e--11 | 11 | 12 | 35S primary transcript processing(-7.191856), | Mod 2644 |
| TCC4CAT | e--11 | 13 | 25 | protein-nucleus export(-5.4714), mRNA-nucleus export(-4.940452), nuclear organization and biogenesis(-4.723204), transcription\, DNA-dependent(-2.518609), RNA processing(-2.083301), mitotic cell cycle(-1.82473), | Mod 760 |
| CAT4TTA | e--11 | 9 | 10 | DNA metabolism(-3.208747), | Mod 2122 |
| TG2ACGC | e--11 | 8 | 16 | | Mod 1001 |
| AAT:GGC | e--11 | 17 | 41 | | Mod 1404 |
| CAA6GCA | e--11 | 11 | 17 | | Mod 2408 |
| AAT;CCT | e--11 | 10 | 14 | mating (sensu Fungi)(-7.740327), | Mod 1177 |
| CCC6ACC | e--11 | 8 | 18 | ergosterol metabolism(-5.975712), steroid biosynthesis(-5.322551), protein biosynthesis(-2.472009), | Mod 1983 |
| AC7TAAG | e--11 | 8 | 11 | | Mod 2667 |
| AA6CCAT | e--11 | 19 | 32 | | Mod 1229 |
| TGA8AAG | e--11 | 16 | 23 | | Mod 1886 |
| TG1GGGG | e--11 | 12 | 49 | hexose transport(-23.587561), | Mod 1028 |
| CG6GGTC | e--11 | 8 | 30 | response to abiotic stimulus(-3.415766), | Mod 1692 |
| AAC4TAG | e--11 | 10 | 16 | meiosis(-4.493325), DNA replication and chromosome cycle(-3.188395), mitotic cell cycle(-2.637696), DNA metabolism(-2.3322), | Mod 689 |
| GGC3TAT | e--11 | 10 | 18 | | Mod 1336 |
| CTA9CCT | e--11 | 10 | 22 | cytoskeleton organization and biogenesis(-3.164818), | Mod 627 |
| ATGCAA | e--11 | 9 | 11 | | Mod 2998 |
| CTC6CCC | e--11 | 6 | 10 | | Mod 147 |
| CTA3TTT | e--11 | 13 | 15 | | Mod 153 |
| TCC1TAC | e--11 | 9 | 15 | protein biosynthesis(-30.488054), | Mod 3043 |
| GGT5CCG | e--11 | 6 | 13 | | Mod 2061 |
| AC2TACT | e--11 | 15 | 30 | phosphate metabolism(-3.685334), | Mod 2709 |
| TATTTA | e--11 | 12 | 12 | | Mod 194 |
| GC9CTTC | e--11 | 8 | 11 | | Mod 1885 |
| AC1TGCG | e--11 | 10 | 30 | chromatin modification(-3.021854), RNA processing(-1.759309), transcription\, DNA-dependent(-2.019946), protein modification(-1.499041), | Mod 901 |
| TTT1TCC | e--11 | 12 | 14 | protein biosynthesis(-2.463443), | Mod 1880 |
| TC5TGTA | e--11 | 8 | 10 | mitosis(-5.450191), | Mod 498 |
| AA;GCCC | e--11 | 12 | 29 | | Mod 2096 |
| TTGCCG | e--11 | 8 | 13 | amino acid transport(-29.473613), | Mod 3224 |
| GAT1ACG | e--11 | 7 | 10 | | Mod 2092 |
| GGGGGC | e--11 | 8 | 29 | phosphorylation(-15.696222), energy derivation by oxidation of organic compounds(-21.20238), energy coupled proton transport\, down the electrochemical gradient(-14.887264), complex III (ubiquinone to cytochrome c)(-12.128788), tricarboxylic acid cycle(-10.049661), TCA intermediate metabolism(-8.850927), aerobic respiration(-6.134305), | Mod 895 |
| GCC9AGC | e--11 | 6 | 10 | ribosomal large subunit assembly and maintenance(-8.807078), transcription\, from Pol I promoter(-6.652269), RNA processing(-4.985827), | Mod 3025 |
| TTGAAT | e--11 | 34 | 57 | transcription\, from Pol II promoter(-7.053881), mitotic cell cycle(-4.453792), | Mod 2968 |
| CGCACG | e--11 | 21 | 165 | | Mod 2302 |
| ATT3TTA | e--11 | 11 | 11 | amino acid biosynthesis(-13.414624), | Mod 1322 |
| TTC:GTG | e--11 | 9 | 13 | | Mod 976 |
| TG5CGGC | e--11 | 23 | 166 | protein modification(-4.567945), | Mod 854 |
| AA;GTAT | e--11 | 19 | 29 | | Mod 2918 |
| AAACCC | e--11 | 8 | 11 | protein biosynthesis(-28.496041), | Mod 143 |
| GCT;GCC | e--11 | 6 | 10 | | Mod 1526 |
| AA1GGAC | e--11 | 41 | 150 | | Mod 1576 |
| CT3AACT | e--11 | 11 | 17 | | Mod 118 |
| CGT5GTG | e--11 | 9 | 18 | carbohydrate metabolism(-3.320471), | Mod 1564 |
| GAAAGA | e--11 | 10 | 10 | | Mod 2156 |
| GAC8GGC | e--11 | 6 | 12 | | Mod 169 |
| CAC9CTT | e--11 | 31 | 105 | protein modification(-7.651924), | Mod 1048 |
| ACCCCT | e--11 | 11 | 34 | stress response(-8.352757), carbohydrate metabolism(-6.249083), protein folding(-4.624379), energy derivation by oxidation of organic compounds(-2.269703), catabolism(-1.50447), DNA metabolism(-1.285501), | Mod 985 |
| TGC:TGC | e--11 | 7 | 10 | | Mod 2516 |
| ATA2GGG | e--11 | 7 | 10 | | Mod 1273 |
| CCC;AGC | e--11 | 10 | 32 | | Mod 1358 |
| TG8ACAT | e--11 | 8 | 10 | protein biosynthesis(-3.096517), | Mod 2324 |
| GA1AACA | e--11 | 14 | 19 | energy coupled proton transport\, down the electrochemical gradient(-7.447285), protein biosynthesis(-2.658848), | Mod 2327 |
| TAG4GAG | e--11 | 8 | 14 | mating-type specific transcriptional control(-11.137922), nitrogen metabolism(-7.092453), amino acid biosynthesis(-5.048664), transcription regulation\, from Pol II promoter(-4.340348), | Mod 167 |
| GC4GGGC | e--11 | 6 | 13 | ergosterol metabolism(-16.245294), steroid biosynthesis(-14.853106), | Mod 2240 |
| CTA7CCG | e--11 | 10 | 34 | protein biosynthesis(-77.119309), | Mod 1209 |
| TGA1TGT | e--11 | 18 | 41 | ubiquitin-dependent protein degradation(-9.582348), | Mod 1382 |
| AC2CTGT | e--11 | 14 | 32 | exocytosis(-2.379977), establishment and/or maintenance of chromatin architecture(-2.555354), protein targeting(-1.980839), catabolism(-1.422193), | Mod 2150 |
| CC2CCCT | e--11 | 11 | 32 | | Mod 2615 |
| TA6CCTT | e--11 | 12 | 17 | stress response(-5.455706), | Mod 519 |
| TC9ACGG | e--11 | 6 | 10 | | Mod 261 |
| ATT9TTG | e--11 | 11 | 12 | G2/M transition of mitotic cell cycle(-7.019372), G1/S transition of mitotic cell cycle(-6.690304), S phase of mitotic cell cycle(-4.925586), DNA metabolism(-4.605821), DNA replication and chromosome cycle(-3.445454), | Mod 2958 |
| CGT2TAA | e--11 | 15 | 37 | | Mod 660 |
| CTA6CCG | e--11 | 6 | 11 | | Mod 1402 |
| ATC7AAC | e--11 | 8 | 10 | | Mod 1620 |
| GG9CGCA | e--11 | 8 | 19 | | Mod 1676 |
| CT5AAAG | e--11 | 9 | 10 | mitotic cell cycle(-2.637696), M phase(-2.630743), | Mod 2082 |
| TTGTCC | e--11 | 24 | 72 | | Mod 2493 |
| GG;CATG | e--11 | 8 | 17 | mating (sensu Fungi)(-7.197754), | Mod 205 |
| ACGCAT | e--11 | 7 | 10 | | Mod 2209 |
| GT4GGGG | e--11 | 6 | 12 | | Mod 1742 |
| GAG:CCG | e--11 | 6 | 13 | DNA metabolism(-5.114591), | Mod 2599 |
| AC6AGTC | e--11 | 11 | 29 | ubiquitin-dependent protein degradation(-9.193256), | Mod 768 |
| CTA2GTA | e--11 | 9 | 14 | protein biosynthesis(-7.894039), | Mod 1869 |
| GT;GGCA | e--11 | 8 | 15 | sulfate assimilation(-16.128527), amino acid biosynthesis(-8.035744), methionine metabolism(-7.628791), | Mod 2985 |
| GC5ACGT | e--11 | 29 | 212 | carbohydrate metabolism(-18.290326), catabolism(-10.252941), | Mod 1242 |
| AT7GCAG | e--11 | 11 | 19 | | Mod 796 |
| CCC1TTA | e--11 | 9 | 15 | carbohydrate metabolism(-4.120891), | Mod 989 |
| TCAGGT | e--11 | 17 | 51 | protein biosynthesis(-2.121021), | Mod 876 |
| TCC:TAG | e--11 | 7 | 11 | mitosis(-4.95897), | Mod 497 |